About (1S)-1-(3-bromo-2,4,5,6-tetrafluorophenyl)ethanamine
(1S)-1-(3-bromo-2,4,5,6-tetrafluorophenyl)ethanamine (PubChem CID 130664379) has the molecular formula C8H6BrF4N
and a molecular weight of 272.04 g/mol. Its IUPAC name is (1S)-1-(3-bromo-2,4,5,6-tetrafluorophenyl)ethanamine.
Molecular Properties
| Compound Name | (1S)-1-(3-bromo-2,4,5,6-tetrafluorophenyl)ethanamine |
| PubChem CID | 130664379 |
| Molecular Formula | C8H6BrF4N |
| Molecular Weight | 272.04 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | (1S)-1-(3-bromo-2,4,5,6-tetrafluorophenyl)ethanamine |
| SMILES | C[C@H](N)c1c(F)c(F)c(F)c(Br)c1F |
| InChI | InChI=1S/C8H6BrF4N/c1-2(14)3-5(10)4(9)7(12)8(13)6(3)11/h2H,14H2,1H3/t2-/m0/s1 |
| InChIKey | MABZVKVJSKHJKH-REOHCLBHSA-N |
| XLogP | 3.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.04 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-(3-bromo-2,4,5,6-tetrafluorophenyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(3-bromo-2,4,5,6-tetrafluorophenyl)ethanamine?
The IUPAC name of (1S)-1-(3-bromo-2,4,5,6-tetrafluorophenyl)ethanamine (CID 130664379) is (1S)-1-(3-bromo-2,4,5,6-tetrafluorophenyl)ethanamine.
What is the SMILES notation for (1S)-1-(3-bromo-2,4,5,6-tetrafluorophenyl)ethanamine?
The canonical SMILES for (1S)-1-(3-bromo-2,4,5,6-tetrafluorophenyl)ethanamine is C[C@H](N)c1c(F)c(F)c(F)c(Br)c1F.
What is the InChIKey of (1S)-1-(3-bromo-2,4,5,6-tetrafluorophenyl)ethanamine?
The InChIKey is MABZVKVJSKHJKH-REOHCLBHSA-N. The full InChI is InChI=1S/C8H6BrF4N/c1-2(14)3-5(10)4(9)7(12)8(13)6(3)11/h2H,14H2,1H3/t2-/m0/s1.
What are the key properties of (1S)-1-(3-bromo-2,4,5,6-tetrafluorophenyl)ethanamine?
(1S)-1-(3-bromo-2,4,5,6-tetrafluorophenyl)ethanamine has a molecular weight of 272.04 g/mol, XLogP of 3.03, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(3-bromo-2,4,5,6-tetrafluorophenyl)ethanamine is sourced from PubChem (CID 130664379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).