C8H6BrF4N — CID 130664379
(1S)-1-(3-bromo-2,4,5,6-tetrafluorophenyl)ethanamine (PubChem CID 130664379) has the molecular formula C8H6BrF4N and a molecular weight of 272.04 g/mol. Its IUPAC name is (1S)-1-(3-bromo-2,4,5,6-tetrafluorophenyl)ethanamine.
| Compound Name | (1S)-1-(3-bromo-2,4,5,6-tetrafluorophenyl)ethanamine |
|---|---|
| PubChem CID | 130664379 |
| Molecular Formula | C8H6BrF4N |
| Molecular Weight | 272.04 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | (1S)-1-(3-bromo-2,4,5,6-tetrafluorophenyl)ethanamine |
| SMILES | C[C@H](N)c1c(F)c(F)c(F)c(Br)c1F |
| InChI | InChI=1S/C8H6BrF4N/c1-2(14)3-5(10)4(9)7(12)8(13)6(3)11/h2H,14H2,1H3/t2-/m0/s1 |
| InChIKey | MABZVKVJSKHJKH-REOHCLBHSA-N |
| XLogP | 3.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.04 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|