About 5-cyanopyrazolo[1,5-a]pyridine-3-carboxamide
5-cyanopyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 130664445) has the molecular formula C9H6N4O
and a molecular weight of 186.17 g/mol. Its IUPAC name is 5-cyanopyrazolo[1,5-a]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 5-cyanopyrazolo[1,5-a]pyridine-3-carboxamide |
| PubChem CID | 130664445 |
| Molecular Formula | C9H6N4O |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 5-cyanopyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | N#Cc1ccn2ncc(C(N)=O)c2c1 |
| InChI | InChI=1S/C9H6N4O/c10-4-6-1-2-13-8(3-6)7(5-12-13)9(11)14/h1-3,5H,(H2,11,14) |
| InChIKey | GNRPKBFMAKVAPB-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-cyanopyrazolo[1,5-a]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyanopyrazolo[1,5-a]pyridine-3-carboxamide?
The IUPAC name of 5-cyanopyrazolo[1,5-a]pyridine-3-carboxamide (CID 130664445) is 5-cyanopyrazolo[1,5-a]pyridine-3-carboxamide.
What is the SMILES notation for 5-cyanopyrazolo[1,5-a]pyridine-3-carboxamide?
The canonical SMILES for 5-cyanopyrazolo[1,5-a]pyridine-3-carboxamide is N#Cc1ccn2ncc(C(N)=O)c2c1.
What is the InChIKey of 5-cyanopyrazolo[1,5-a]pyridine-3-carboxamide?
The InChIKey is GNRPKBFMAKVAPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N4O/c10-4-6-1-2-13-8(3-6)7(5-12-13)9(11)14/h1-3,5H,(H2,11,14).
What are the key properties of 5-cyanopyrazolo[1,5-a]pyridine-3-carboxamide?
5-cyanopyrazolo[1,5-a]pyridine-3-carboxamide has a molecular weight of 186.17 g/mol, XLogP of 0.30, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyanopyrazolo[1,5-a]pyridine-3-carboxamide is sourced from PubChem (CID 130664445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).