About 2-(chloromethyl)-4-(1,3-dioxolan-2-yl)-1,3-thiazole
2-(chloromethyl)-4-(1,3-dioxolan-2-yl)-1,3-thiazole (PubChem CID 130665277) has the molecular formula C7H8ClNO2S
and a molecular weight of 205.67 g/mol. Its IUPAC name is 2-(chloromethyl)-4-(1,3-dioxolan-2-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(chloromethyl)-4-(1,3-dioxolan-2-yl)-1,3-thiazole |
| PubChem CID | 130665277 |
| Molecular Formula | C7H8ClNO2S |
| Molecular Weight | 205.67 g/mol |
| Exact Mass | 205.00 |
| IUPAC Name | 2-(chloromethyl)-4-(1,3-dioxolan-2-yl)-1,3-thiazole |
| SMILES | ClCc1nc(C2OCCO2)cs1 |
| InChI | InChI=1S/C7H8ClNO2S/c8-3-6-9-5(4-12-6)7-10-1-2-11-7/h4,7H,1-3H2 |
| InChIKey | CJTKGGLLTIMJPQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.67 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-4-(1,3-dioxolan-2-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-4-(1,3-dioxolan-2-yl)-1,3-thiazole?
The IUPAC name of 2-(chloromethyl)-4-(1,3-dioxolan-2-yl)-1,3-thiazole (CID 130665277) is 2-(chloromethyl)-4-(1,3-dioxolan-2-yl)-1,3-thiazole.
What is the SMILES notation for 2-(chloromethyl)-4-(1,3-dioxolan-2-yl)-1,3-thiazole?
The canonical SMILES for 2-(chloromethyl)-4-(1,3-dioxolan-2-yl)-1,3-thiazole is ClCc1nc(C2OCCO2)cs1.
What is the InChIKey of 2-(chloromethyl)-4-(1,3-dioxolan-2-yl)-1,3-thiazole?
The InChIKey is CJTKGGLLTIMJPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClNO2S/c8-3-6-9-5(4-12-6)7-10-1-2-11-7/h4,7H,1-3H2.
What are the key properties of 2-(chloromethyl)-4-(1,3-dioxolan-2-yl)-1,3-thiazole?
2-(chloromethyl)-4-(1,3-dioxolan-2-yl)-1,3-thiazole has a molecular weight of 205.67 g/mol, XLogP of 1.93, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-4-(1,3-dioxolan-2-yl)-1,3-thiazole is sourced from PubChem (CID 130665277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).