About (4R)-4,6-diamino-3,4-dihydro-2H-chromene-8-carbonitrile
(4R)-4,6-diamino-3,4-dihydro-2H-chromene-8-carbonitrile (PubChem CID 130665310) has the molecular formula C10H11N3O
and a molecular weight of 189.22 g/mol. Its IUPAC name is (4R)-4,6-diamino-3,4-dihydro-2H-chromene-8-carbonitrile.
Molecular Properties
| Compound Name | (4R)-4,6-diamino-3,4-dihydro-2H-chromene-8-carbonitrile |
| PubChem CID | 130665310 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | (4R)-4,6-diamino-3,4-dihydro-2H-chromene-8-carbonitrile |
| SMILES | N#Cc1cc(N)cc2c1OCC[C@H]2N |
| InChI | InChI=1S/C10H11N3O/c11-5-6-3-7(12)4-8-9(13)1-2-14-10(6)8/h3-4,9H,1-2,12-13H2/t9-/m1/s1 |
| InChIKey | WAMBQAQPCFPOKY-SECBINFHSA-N |
| XLogP | 0.92 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4,6-diamino-3,4-dihydro-2H-chromene-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4,6-diamino-3,4-dihydro-2H-chromene-8-carbonitrile?
The IUPAC name of (4R)-4,6-diamino-3,4-dihydro-2H-chromene-8-carbonitrile (CID 130665310) is (4R)-4,6-diamino-3,4-dihydro-2H-chromene-8-carbonitrile.
What is the SMILES notation for (4R)-4,6-diamino-3,4-dihydro-2H-chromene-8-carbonitrile?
The canonical SMILES for (4R)-4,6-diamino-3,4-dihydro-2H-chromene-8-carbonitrile is N#Cc1cc(N)cc2c1OCC[C@H]2N.
What is the InChIKey of (4R)-4,6-diamino-3,4-dihydro-2H-chromene-8-carbonitrile?
The InChIKey is WAMBQAQPCFPOKY-SECBINFHSA-N. The full InChI is InChI=1S/C10H11N3O/c11-5-6-3-7(12)4-8-9(13)1-2-14-10(6)8/h3-4,9H,1-2,12-13H2/t9-/m1/s1.
What are the key properties of (4R)-4,6-diamino-3,4-dihydro-2H-chromene-8-carbonitrile?
(4R)-4,6-diamino-3,4-dihydro-2H-chromene-8-carbonitrile has a molecular weight of 189.22 g/mol, XLogP of 0.92, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4,6-diamino-3,4-dihydro-2H-chromene-8-carbonitrile is sourced from PubChem (CID 130665310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).