About 5-bromo-N-(2-bromo-2,2-difluoroethyl)-1-methylpyrazole-4-carboxamide
5-bromo-N-(2-bromo-2,2-difluoroethyl)-1-methylpyrazole-4-carboxamide (PubChem CID 130665485) has the molecular formula C7H7Br2F2N3O
and a molecular weight of 346.96 g/mol. Its IUPAC name is 5-bromo-N-(2-bromo-2,2-difluoroethyl)-1-methylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-(2-bromo-2,2-difluoroethyl)-1-methylpyrazole-4-carboxamide |
| PubChem CID | 130665485 |
| Molecular Formula | C7H7Br2F2N3O |
| Molecular Weight | 346.96 g/mol |
| Exact Mass | 344.89 |
| IUPAC Name | 5-bromo-N-(2-bromo-2,2-difluoroethyl)-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1ncc(C(=O)NCC(F)(F)Br)c1Br |
| InChI | InChI=1S/C7H7Br2F2N3O/c1-14-5(8)4(2-13-14)6(15)12-3-7(9,10)11/h2H,3H2,1H3,(H,12,15) |
| InChIKey | QAMZTAZDXCGBTB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.96 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N-(2-bromo-2,2-difluoroethyl)-1-methylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(2-bromo-2,2-difluoroethyl)-1-methylpyrazole-4-carboxamide?
The IUPAC name of 5-bromo-N-(2-bromo-2,2-difluoroethyl)-1-methylpyrazole-4-carboxamide (CID 130665485) is 5-bromo-N-(2-bromo-2,2-difluoroethyl)-1-methylpyrazole-4-carboxamide.
What is the SMILES notation for 5-bromo-N-(2-bromo-2,2-difluoroethyl)-1-methylpyrazole-4-carboxamide?
The canonical SMILES for 5-bromo-N-(2-bromo-2,2-difluoroethyl)-1-methylpyrazole-4-carboxamide is Cn1ncc(C(=O)NCC(F)(F)Br)c1Br.
What is the InChIKey of 5-bromo-N-(2-bromo-2,2-difluoroethyl)-1-methylpyrazole-4-carboxamide?
The InChIKey is QAMZTAZDXCGBTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Br2F2N3O/c1-14-5(8)4(2-13-14)6(15)12-3-7(9,10)11/h2H,3H2,1H3,(H,12,15).
What are the key properties of 5-bromo-N-(2-bromo-2,2-difluoroethyl)-1-methylpyrazole-4-carboxamide?
5-bromo-N-(2-bromo-2,2-difluoroethyl)-1-methylpyrazole-4-carboxamide has a molecular weight of 346.96 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(2-bromo-2,2-difluoroethyl)-1-methylpyrazole-4-carboxamide is sourced from PubChem (CID 130665485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).