C8H11F2NO — CID 130665704
(1R)-1-(4,5-dimethylfuran-2-yl)-2,2-difluoroethanamine (PubChem CID 130665704) has the molecular formula C8H11F2NO and a molecular weight of 175.18 g/mol. Its IUPAC name is (1R)-1-(4,5-dimethylfuran-2-yl)-2,2-difluoroethanamine.
| Compound Name | (1R)-1-(4,5-dimethylfuran-2-yl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 130665704 |
| Molecular Formula | C8H11F2NO |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (1R)-1-(4,5-dimethylfuran-2-yl)-2,2-difluoroethanamine |
| SMILES | Cc1cc([C@@H](N)C(F)F)oc1C |
| InChI | InChI=1S/C8H11F2NO/c1-4-3-6(12-5(4)2)7(11)8(9)10/h3,7-8H,11H2,1-2H3/t7-/m1/s1 |
| InChIKey | HFNIERHSLRZTBK-SSDOTTSWSA-N |
| XLogP | 2.16 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |