About (1R)-1-(4,5-dimethylfuran-2-yl)-2,2-difluoroethanamine
(1R)-1-(4,5-dimethylfuran-2-yl)-2,2-difluoroethanamine (PubChem CID 130665704) has the molecular formula C8H11F2NO
and a molecular weight of 175.18 g/mol. Its IUPAC name is (1R)-1-(4,5-dimethylfuran-2-yl)-2,2-difluoroethanamine.
Molecular Properties
| Compound Name | (1R)-1-(4,5-dimethylfuran-2-yl)-2,2-difluoroethanamine |
| PubChem CID | 130665704 |
| Molecular Formula | C8H11F2NO |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (1R)-1-(4,5-dimethylfuran-2-yl)-2,2-difluoroethanamine |
| SMILES | Cc1cc([C@@H](N)C(F)F)oc1C |
| InChI | InChI=1S/C8H11F2NO/c1-4-3-6(12-5(4)2)7(11)8(9)10/h3,7-8H,11H2,1-2H3/t7-/m1/s1 |
| InChIKey | HFNIERHSLRZTBK-SSDOTTSWSA-N |
| XLogP | 2.16 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-1-(4,5-dimethylfuran-2-yl)-2,2-difluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(4,5-dimethylfuran-2-yl)-2,2-difluoroethanamine?
The IUPAC name of (1R)-1-(4,5-dimethylfuran-2-yl)-2,2-difluoroethanamine (CID 130665704) is (1R)-1-(4,5-dimethylfuran-2-yl)-2,2-difluoroethanamine.
What is the SMILES notation for (1R)-1-(4,5-dimethylfuran-2-yl)-2,2-difluoroethanamine?
The canonical SMILES for (1R)-1-(4,5-dimethylfuran-2-yl)-2,2-difluoroethanamine is Cc1cc([C@@H](N)C(F)F)oc1C.
What is the InChIKey of (1R)-1-(4,5-dimethylfuran-2-yl)-2,2-difluoroethanamine?
The InChIKey is HFNIERHSLRZTBK-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H11F2NO/c1-4-3-6(12-5(4)2)7(11)8(9)10/h3,7-8H,11H2,1-2H3/t7-/m1/s1.
What are the key properties of (1R)-1-(4,5-dimethylfuran-2-yl)-2,2-difluoroethanamine?
(1R)-1-(4,5-dimethylfuran-2-yl)-2,2-difluoroethanamine has a molecular weight of 175.18 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(4,5-dimethylfuran-2-yl)-2,2-difluoroethanamine is sourced from PubChem (CID 130665704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).