About 2-(1,2,4-triazol-1-yl)ethylurea
2-(1,2,4-triazol-1-yl)ethylurea (PubChem CID 130666026) has the molecular formula C5H9N5O
and a molecular weight of 155.16 g/mol. Its IUPAC name is 2-(1,2,4-triazol-1-yl)ethylurea.
Molecular Properties
| Compound Name | 2-(1,2,4-triazol-1-yl)ethylurea |
| PubChem CID | 130666026 |
| Molecular Formula | C5H9N5O |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 2-(1,2,4-triazol-1-yl)ethylurea |
| SMILES | NC(=O)NCCn1cncn1 |
| InChI | InChI=1S/C5H9N5O/c6-5(11)8-1-2-10-4-7-3-9-10/h3-4H,1-2H2,(H3,6,8,11) |
| InChIKey | UWMWLGZWNOSVKV-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,2,4-triazol-1-yl)ethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2,4-triazol-1-yl)ethylurea?
The IUPAC name of 2-(1,2,4-triazol-1-yl)ethylurea (CID 130666026) is 2-(1,2,4-triazol-1-yl)ethylurea.
What is the SMILES notation for 2-(1,2,4-triazol-1-yl)ethylurea?
The canonical SMILES for 2-(1,2,4-triazol-1-yl)ethylurea is NC(=O)NCCn1cncn1.
What is the InChIKey of 2-(1,2,4-triazol-1-yl)ethylurea?
The InChIKey is UWMWLGZWNOSVKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5O/c6-5(11)8-1-2-10-4-7-3-9-10/h3-4H,1-2H2,(H3,6,8,11).
What are the key properties of 2-(1,2,4-triazol-1-yl)ethylurea?
2-(1,2,4-triazol-1-yl)ethylurea has a molecular weight of 155.16 g/mol, XLogP of -1.05, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,4-triazol-1-yl)ethylurea is sourced from PubChem (CID 130666026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).