About N-(2,2-difluoroethyl)-1,3-oxazole-5-carboxamide
N-(2,2-difluoroethyl)-1,3-oxazole-5-carboxamide (PubChem CID 130666663) has the molecular formula C6H6F2N2O2
and a molecular weight of 176.12 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-1,3-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(2,2-difluoroethyl)-1,3-oxazole-5-carboxamide |
| PubChem CID | 130666663 |
| Molecular Formula | C6H6F2N2O2 |
| Molecular Weight | 176.12 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | N-(2,2-difluoroethyl)-1,3-oxazole-5-carboxamide |
| SMILES | O=C(NCC(F)F)c1cnco1 |
| InChI | InChI=1S/C6H6F2N2O2/c7-5(8)2-10-6(11)4-1-9-3-12-4/h1,3,5H,2H2,(H,10,11) |
| InChIKey | JCOFXUAUHOVIIE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.12 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,2-difluoroethyl)-1,3-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoroethyl)-1,3-oxazole-5-carboxamide?
The IUPAC name of N-(2,2-difluoroethyl)-1,3-oxazole-5-carboxamide (CID 130666663) is N-(2,2-difluoroethyl)-1,3-oxazole-5-carboxamide.
What is the SMILES notation for N-(2,2-difluoroethyl)-1,3-oxazole-5-carboxamide?
The canonical SMILES for N-(2,2-difluoroethyl)-1,3-oxazole-5-carboxamide is O=C(NCC(F)F)c1cnco1.
What is the InChIKey of N-(2,2-difluoroethyl)-1,3-oxazole-5-carboxamide?
The InChIKey is JCOFXUAUHOVIIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6F2N2O2/c7-5(8)2-10-6(11)4-1-9-3-12-4/h1,3,5H,2H2,(H,10,11).
What are the key properties of N-(2,2-difluoroethyl)-1,3-oxazole-5-carboxamide?
N-(2,2-difluoroethyl)-1,3-oxazole-5-carboxamide has a molecular weight of 176.12 g/mol, XLogP of 0.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoroethyl)-1,3-oxazole-5-carboxamide is sourced from PubChem (CID 130666663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).