About 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide
2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide (PubChem CID 130666700) has the molecular formula C9H17NOS
and a molecular weight of 187.31 g/mol. Its IUPAC name is 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide.
Molecular Properties
| Compound Name | 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide |
| PubChem CID | 130666700 |
| Molecular Formula | C9H17NOS |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide |
| SMILES | C=CCN1CCS(=O)C(C)C1C |
| InChI | InChI=1S/C9H17NOS/c1-4-5-10-6-7-12(11)9(3)8(10)2/h4,8-9H,1,5-7H2,2-3H3 |
| InChIKey | OHOTXQTYLVPVQI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide?
The IUPAC name of 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide (CID 130666700) is 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide.
What is the SMILES notation for 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide?
The canonical SMILES for 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide is C=CCN1CCS(=O)C(C)C1C.
What is the InChIKey of 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide?
The InChIKey is OHOTXQTYLVPVQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NOS/c1-4-5-10-6-7-12(11)9(3)8(10)2/h4,8-9H,1,5-7H2,2-3H3.
What are the key properties of 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide?
2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide has a molecular weight of 187.31 g/mol, XLogP of 1.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide is sourced from PubChem (CID 130666700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).