2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide

C9H17NOS — CID 130666700

IUPAC2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide
SMILESC=CCN1CCS(=O)C(C)C1C
InChIInChI=1S/C9H17NOS/c1-4-5-10-6-7-12(11)9(3)8(10)2/h4,8-9H,1,5-7H2,2-3H3
InChIKeyOHOTXQTYLVPVQI-UHFFFAOYSA-N
MW187.31 g/mol
LogP1.01
Rot. Bonds2

About 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide

2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide (PubChem CID 130666700) has the molecular formula C9H17NOS and a molecular weight of 187.31 g/mol. Its IUPAC name is 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide.

Molecular Properties

Compound Name2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide
PubChem CID130666700
Molecular FormulaC9H17NOS
Molecular Weight187.31 g/mol
Exact Mass187.10
IUPAC Name2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide
SMILESC=CCN1CCS(=O)C(C)C1C
InChIInChI=1S/C9H17NOS/c1-4-5-10-6-7-12(11)9(3)8(10)2/h4,8-9H,1,5-7H2,2-3H3
InChIKeyOHOTXQTYLVPVQI-UHFFFAOYSA-N
XLogP1.01
TPSA20.31 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.31
LogP ≤ 51.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide?
The IUPAC name of 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide (CID 130666700) is 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide.
What is the SMILES notation for 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide?
The canonical SMILES for 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide is C=CCN1CCS(=O)C(C)C1C.
What is the InChIKey of 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide?
The InChIKey is OHOTXQTYLVPVQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NOS/c1-4-5-10-6-7-12(11)9(3)8(10)2/h4,8-9H,1,5-7H2,2-3H3.
What are the key properties of 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide?
2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide has a molecular weight of 187.31 g/mol, XLogP of 1.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-4-prop-2-enyl-1,4-thiazinane 1-oxide is sourced from PubChem (CID 130666700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).