C9H15NO3 — CID 130666759
N-(2-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 130666759) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | N-(2-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 130666759 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | N-(2-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CC(O)CNC(=O)C1=CCCCO1 |
| InChI | InChI=1S/C9H15NO3/c1-7(11)6-10-9(12)8-4-2-3-5-13-8/h4,7,11H,2-3,5-6H2,1H3,(H,10,12) |
| InChIKey | JKYQAZMTSZDSIE-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |