C9H14N2OS — CID 130667065
N-ethyl-N,2,4-trimethyl-1,3-thiazole-5-carboxamide (PubChem CID 130667065) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is N-ethyl-N,2,4-trimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-ethyl-N,2,4-trimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 130667065 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | N-ethyl-N,2,4-trimethyl-1,3-thiazole-5-carboxamide |
| SMILES | CCN(C)C(=O)c1sc(C)nc1C |
| InChI | InChI=1S/C9H14N2OS/c1-5-11(4)9(12)8-6(2)10-7(3)13-8/h5H2,1-4H3 |
| InChIKey | JHMNLORQYIEDNG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |