About 1-methoxy-3-(2-methyl-1,2,4-triazol-3-yl)urea
1-methoxy-3-(2-methyl-1,2,4-triazol-3-yl)urea (PubChem CID 130667068) has the molecular formula C5H9N5O2
and a molecular weight of 171.16 g/mol. Its IUPAC name is 1-methoxy-3-(2-methyl-1,2,4-triazol-3-yl)urea.
Molecular Properties
| Compound Name | 1-methoxy-3-(2-methyl-1,2,4-triazol-3-yl)urea |
| PubChem CID | 130667068 |
| Molecular Formula | C5H9N5O2 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 1-methoxy-3-(2-methyl-1,2,4-triazol-3-yl)urea |
| SMILES | CONC(=O)Nc1ncnn1C |
| InChI | InChI=1S/C5H9N5O2/c1-10-4(6-3-7-10)8-5(11)9-12-2/h3H,1-2H3,(H2,6,7,8,9,11) |
| InChIKey | NCVGOJKUCNOTSC-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-3-(2-methyl-1,2,4-triazol-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-3-(2-methyl-1,2,4-triazol-3-yl)urea?
The IUPAC name of 1-methoxy-3-(2-methyl-1,2,4-triazol-3-yl)urea (CID 130667068) is 1-methoxy-3-(2-methyl-1,2,4-triazol-3-yl)urea.
What is the SMILES notation for 1-methoxy-3-(2-methyl-1,2,4-triazol-3-yl)urea?
The canonical SMILES for 1-methoxy-3-(2-methyl-1,2,4-triazol-3-yl)urea is CONC(=O)Nc1ncnn1C.
What is the InChIKey of 1-methoxy-3-(2-methyl-1,2,4-triazol-3-yl)urea?
The InChIKey is NCVGOJKUCNOTSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5O2/c1-10-4(6-3-7-10)8-5(11)9-12-2/h3H,1-2H3,(H2,6,7,8,9,11).
What are the key properties of 1-methoxy-3-(2-methyl-1,2,4-triazol-3-yl)urea?
1-methoxy-3-(2-methyl-1,2,4-triazol-3-yl)urea has a molecular weight of 171.16 g/mol, XLogP of -0.50, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-3-(2-methyl-1,2,4-triazol-3-yl)urea is sourced from PubChem (CID 130667068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).