About 1-[(5-bromo-1,3-thiazol-2-yl)amino]-2,3-dimethylbutan-2-ol
1-[(5-bromo-1,3-thiazol-2-yl)amino]-2,3-dimethylbutan-2-ol (PubChem CID 130667344) has the molecular formula C9H15BrN2OS
and a molecular weight of 279.20 g/mol. Its IUPAC name is 1-[(5-bromo-1,3-thiazol-2-yl)amino]-2,3-dimethylbutan-2-ol.
Molecular Properties
| Compound Name | 1-[(5-bromo-1,3-thiazol-2-yl)amino]-2,3-dimethylbutan-2-ol |
| PubChem CID | 130667344 |
| Molecular Formula | C9H15BrN2OS |
| Molecular Weight | 279.20 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 1-[(5-bromo-1,3-thiazol-2-yl)amino]-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)C(C)(O)CNc1ncc(Br)s1 |
| InChI | InChI=1S/C9H15BrN2OS/c1-6(2)9(3,13)5-12-8-11-4-7(10)14-8/h4,6,13H,5H2,1-3H3,(H,11,12) |
| InChIKey | MKIKSTJAVXCWRD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.20 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(5-bromo-1,3-thiazol-2-yl)amino]-2,3-dimethylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-bromo-1,3-thiazol-2-yl)amino]-2,3-dimethylbutan-2-ol?
The IUPAC name of 1-[(5-bromo-1,3-thiazol-2-yl)amino]-2,3-dimethylbutan-2-ol (CID 130667344) is 1-[(5-bromo-1,3-thiazol-2-yl)amino]-2,3-dimethylbutan-2-ol.
What is the SMILES notation for 1-[(5-bromo-1,3-thiazol-2-yl)amino]-2,3-dimethylbutan-2-ol?
The canonical SMILES for 1-[(5-bromo-1,3-thiazol-2-yl)amino]-2,3-dimethylbutan-2-ol is CC(C)C(C)(O)CNc1ncc(Br)s1.
What is the InChIKey of 1-[(5-bromo-1,3-thiazol-2-yl)amino]-2,3-dimethylbutan-2-ol?
The InChIKey is MKIKSTJAVXCWRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15BrN2OS/c1-6(2)9(3,13)5-12-8-11-4-7(10)14-8/h4,6,13H,5H2,1-3H3,(H,11,12).
What are the key properties of 1-[(5-bromo-1,3-thiazol-2-yl)amino]-2,3-dimethylbutan-2-ol?
1-[(5-bromo-1,3-thiazol-2-yl)amino]-2,3-dimethylbutan-2-ol has a molecular weight of 279.20 g/mol, XLogP of 2.72, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-bromo-1,3-thiazol-2-yl)amino]-2,3-dimethylbutan-2-ol is sourced from PubChem (CID 130667344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).