About 5-hydroxy-2,4-dimethylheptanenitrile
5-hydroxy-2,4-dimethylheptanenitrile (PubChem CID 13066783) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is 5-hydroxy-2,4-dimethylheptanenitrile.
Molecular Properties
| Compound Name | 5-hydroxy-2,4-dimethylheptanenitrile |
| PubChem CID | 13066783 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 5-hydroxy-2,4-dimethylheptanenitrile |
| SMILES | CCC(O)C(C)CC(C)C#N |
| InChI | InChI=1S/C9H17NO/c1-4-9(11)8(3)5-7(2)6-10/h7-9,11H,4-5H2,1-3H3 |
| InChIKey | ZBJUNCRJUNAMOJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-hydroxy-2,4-dimethylheptanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2,4-dimethylheptanenitrile?
The IUPAC name of 5-hydroxy-2,4-dimethylheptanenitrile (CID 13066783) is 5-hydroxy-2,4-dimethylheptanenitrile.
What is the SMILES notation for 5-hydroxy-2,4-dimethylheptanenitrile?
The canonical SMILES for 5-hydroxy-2,4-dimethylheptanenitrile is CCC(O)C(C)CC(C)C#N.
What is the InChIKey of 5-hydroxy-2,4-dimethylheptanenitrile?
The InChIKey is ZBJUNCRJUNAMOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO/c1-4-9(11)8(3)5-7(2)6-10/h7-9,11H,4-5H2,1-3H3.
What are the key properties of 5-hydroxy-2,4-dimethylheptanenitrile?
5-hydroxy-2,4-dimethylheptanenitrile has a molecular weight of 155.24 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2,4-dimethylheptanenitrile is sourced from PubChem (CID 13066783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).