About N-cyclobutyl-N,6-dimethylpyridin-2-amine
N-cyclobutyl-N,6-dimethylpyridin-2-amine (PubChem CID 130668195) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is N-cyclobutyl-N,6-dimethylpyridin-2-amine.
Molecular Properties
| Compound Name | N-cyclobutyl-N,6-dimethylpyridin-2-amine |
| PubChem CID | 130668195 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N-cyclobutyl-N,6-dimethylpyridin-2-amine |
| SMILES | Cc1cccc(N(C)C2CCC2)n1 |
| InChI | InChI=1S/C11H16N2/c1-9-5-3-8-11(12-9)13(2)10-6-4-7-10/h3,5,8,10H,4,6-7H2,1-2H3 |
| InChIKey | QHNLCLMUWVFXON-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclobutyl-N,6-dimethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclobutyl-N,6-dimethylpyridin-2-amine?
The IUPAC name of N-cyclobutyl-N,6-dimethylpyridin-2-amine (CID 130668195) is N-cyclobutyl-N,6-dimethylpyridin-2-amine.
What is the SMILES notation for N-cyclobutyl-N,6-dimethylpyridin-2-amine?
The canonical SMILES for N-cyclobutyl-N,6-dimethylpyridin-2-amine is Cc1cccc(N(C)C2CCC2)n1.
What is the InChIKey of N-cyclobutyl-N,6-dimethylpyridin-2-amine?
The InChIKey is QHNLCLMUWVFXON-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-9-5-3-8-11(12-9)13(2)10-6-4-7-10/h3,5,8,10H,4,6-7H2,1-2H3.
What are the key properties of N-cyclobutyl-N,6-dimethylpyridin-2-amine?
N-cyclobutyl-N,6-dimethylpyridin-2-amine has a molecular weight of 176.26 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclobutyl-N,6-dimethylpyridin-2-amine is sourced from PubChem (CID 130668195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).