About (1R)-1-(4,5-dimethylfuran-2-yl)-2-fluoroethanamine
(1R)-1-(4,5-dimethylfuran-2-yl)-2-fluoroethanamine (PubChem CID 130668303) has the molecular formula C8H12FNO
and a molecular weight of 157.19 g/mol. Its IUPAC name is (1R)-1-(4,5-dimethylfuran-2-yl)-2-fluoroethanamine.
Molecular Properties
| Compound Name | (1R)-1-(4,5-dimethylfuran-2-yl)-2-fluoroethanamine |
| PubChem CID | 130668303 |
| Molecular Formula | C8H12FNO |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | (1R)-1-(4,5-dimethylfuran-2-yl)-2-fluoroethanamine |
| SMILES | Cc1cc([C@@H](N)CF)oc1C |
| InChI | InChI=1S/C8H12FNO/c1-5-3-8(7(10)4-9)11-6(5)2/h3,7H,4,10H2,1-2H3/t7-/m0/s1 |
| InChIKey | YJKMEFKXGXLKAW-ZETCQYMHSA-N |
| XLogP | 1.87 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-1-(4,5-dimethylfuran-2-yl)-2-fluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(4,5-dimethylfuran-2-yl)-2-fluoroethanamine?
The IUPAC name of (1R)-1-(4,5-dimethylfuran-2-yl)-2-fluoroethanamine (CID 130668303) is (1R)-1-(4,5-dimethylfuran-2-yl)-2-fluoroethanamine.
What is the SMILES notation for (1R)-1-(4,5-dimethylfuran-2-yl)-2-fluoroethanamine?
The canonical SMILES for (1R)-1-(4,5-dimethylfuran-2-yl)-2-fluoroethanamine is Cc1cc([C@@H](N)CF)oc1C.
What is the InChIKey of (1R)-1-(4,5-dimethylfuran-2-yl)-2-fluoroethanamine?
The InChIKey is YJKMEFKXGXLKAW-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H12FNO/c1-5-3-8(7(10)4-9)11-6(5)2/h3,7H,4,10H2,1-2H3/t7-/m0/s1.
What are the key properties of (1R)-1-(4,5-dimethylfuran-2-yl)-2-fluoroethanamine?
(1R)-1-(4,5-dimethylfuran-2-yl)-2-fluoroethanamine has a molecular weight of 157.19 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(4,5-dimethylfuran-2-yl)-2-fluoroethanamine is sourced from PubChem (CID 130668303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).