C7H14N2O3 — CID 130668438
(3R)-3-(hydroxymethyl)-N-methoxypyrrolidine-1-carboxamide (PubChem CID 130668438) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is (3R)-3-(hydroxymethyl)-N-methoxypyrrolidine-1-carboxamide.
| Compound Name | (3R)-3-(hydroxymethyl)-N-methoxypyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 130668438 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (3R)-3-(hydroxymethyl)-N-methoxypyrrolidine-1-carboxamide |
| SMILES | CONC(=O)N1CC[C@@H](CO)C1 |
| InChI | InChI=1S/C7H14N2O3/c1-12-8-7(11)9-3-2-6(4-9)5-10/h6,10H,2-5H2,1H3,(H,8,11)/t6-/m1/s1 |
| InChIKey | OBQAQXTZHDMOFI-ZCFIWIBFSA-N |
| XLogP | -0.43 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|