C8H13FN2O — CID 130668602
N-cyclopropyl-3-fluoro-3-methylazetidine-1-carboxamide (PubChem CID 130668602) has the molecular formula C8H13FN2O and a molecular weight of 172.20 g/mol. Its IUPAC name is N-cyclopropyl-3-fluoro-3-methylazetidine-1-carboxamide.
| Compound Name | N-cyclopropyl-3-fluoro-3-methylazetidine-1-carboxamide |
|---|---|
| PubChem CID | 130668602 |
| Molecular Formula | C8H13FN2O |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | N-cyclopropyl-3-fluoro-3-methylazetidine-1-carboxamide |
| SMILES | CC1(F)CN(C(=O)NC2CC2)C1 |
| InChI | InChI=1S/C8H13FN2O/c1-8(9)4-11(5-8)7(12)10-6-2-3-6/h6H,2-5H2,1H3,(H,10,12) |
| InChIKey | KNTSMROAHBRPOK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |