C10H17NO — CID 130668952
2-methyl-N-(3-methylcyclobutyl)cyclopropane-1-carboxamide (PubChem CID 130668952) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-methyl-N-(3-methylcyclobutyl)cyclopropane-1-carboxamide.
| Compound Name | 2-methyl-N-(3-methylcyclobutyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 130668952 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-methyl-N-(3-methylcyclobutyl)cyclopropane-1-carboxamide |
| SMILES | CC1CC(NC(=O)C2CC2C)C1 |
| InChI | InChI=1S/C10H17NO/c1-6-3-8(4-6)11-10(12)9-5-7(9)2/h6-9H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | ORNKVCBTKUGLNH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |