About 4-methyl-2-(1,2-oxazol-5-ylmethylsulfanyl)-1,3-oxazole
4-methyl-2-(1,2-oxazol-5-ylmethylsulfanyl)-1,3-oxazole (PubChem CID 130670031) has the molecular formula C8H8N2O2S
and a molecular weight of 196.23 g/mol. Its IUPAC name is 4-methyl-2-(1,2-oxazol-5-ylmethylsulfanyl)-1,3-oxazole.
Molecular Properties
| Compound Name | 4-methyl-2-(1,2-oxazol-5-ylmethylsulfanyl)-1,3-oxazole |
| PubChem CID | 130670031 |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 4-methyl-2-(1,2-oxazol-5-ylmethylsulfanyl)-1,3-oxazole |
| SMILES | Cc1coc(SCc2ccno2)n1 |
| InChI | InChI=1S/C8H8N2O2S/c1-6-4-11-8(10-6)13-5-7-2-3-9-12-7/h2-4H,5H2,1H3 |
| InChIKey | FEDZUEIZBHBTIS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-2-(1,2-oxazol-5-ylmethylsulfanyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-(1,2-oxazol-5-ylmethylsulfanyl)-1,3-oxazole?
The IUPAC name of 4-methyl-2-(1,2-oxazol-5-ylmethylsulfanyl)-1,3-oxazole (CID 130670031) is 4-methyl-2-(1,2-oxazol-5-ylmethylsulfanyl)-1,3-oxazole.
What is the SMILES notation for 4-methyl-2-(1,2-oxazol-5-ylmethylsulfanyl)-1,3-oxazole?
The canonical SMILES for 4-methyl-2-(1,2-oxazol-5-ylmethylsulfanyl)-1,3-oxazole is Cc1coc(SCc2ccno2)n1.
What is the InChIKey of 4-methyl-2-(1,2-oxazol-5-ylmethylsulfanyl)-1,3-oxazole?
The InChIKey is FEDZUEIZBHBTIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2S/c1-6-4-11-8(10-6)13-5-7-2-3-9-12-7/h2-4H,5H2,1H3.
What are the key properties of 4-methyl-2-(1,2-oxazol-5-ylmethylsulfanyl)-1,3-oxazole?
4-methyl-2-(1,2-oxazol-5-ylmethylsulfanyl)-1,3-oxazole has a molecular weight of 196.23 g/mol, XLogP of 2.26, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(1,2-oxazol-5-ylmethylsulfanyl)-1,3-oxazole is sourced from PubChem (CID 130670031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).