C10H12N4 — CID 130670429
4-[(1-methylazetidin-3-yl)amino]pyridine-2-carbonitrile (PubChem CID 130670429) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-[(1-methylazetidin-3-yl)amino]pyridine-2-carbonitrile.
| Compound Name | 4-[(1-methylazetidin-3-yl)amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 130670429 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 4-[(1-methylazetidin-3-yl)amino]pyridine-2-carbonitrile |
| SMILES | CN1CC(Nc2ccnc(C#N)c2)C1 |
| InChI | InChI=1S/C10H12N4/c1-14-6-10(7-14)13-8-2-3-12-9(4-8)5-11/h2-4,10H,6-7H2,1H3,(H,12,13) |
| InChIKey | BWFDWGSFYDCJOJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |