About 1-[[[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]amino]methyl]cyclopropane-1-carbonitrile
1-[[[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]amino]methyl]cyclopropane-1-carbonitrile (PubChem CID 130671350) has the molecular formula C8H10N4OS
and a molecular weight of 210.26 g/mol. Its IUPAC name is 1-[[[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]amino]methyl]cyclopropane-1-carbonitrile.
Molecular Properties
| Compound Name | 1-[[[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]amino]methyl]cyclopropane-1-carbonitrile |
| PubChem CID | 130671350 |
| Molecular Formula | C8H10N4OS |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 1-[[[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]amino]methyl]cyclopropane-1-carbonitrile |
| SMILES | N#CC1(CNc2nnc(CO)s2)CC1 |
| InChI | InChI=1S/C8H10N4OS/c9-4-8(1-2-8)5-10-7-12-11-6(3-13)14-7/h13H,1-3,5H2,(H,10,12) |
| InChIKey | HMMWYIWSWSBTCD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[[[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]amino]methyl]cyclopropane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]amino]methyl]cyclopropane-1-carbonitrile?
The IUPAC name of 1-[[[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]amino]methyl]cyclopropane-1-carbonitrile (CID 130671350) is 1-[[[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]amino]methyl]cyclopropane-1-carbonitrile.
What is the SMILES notation for 1-[[[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]amino]methyl]cyclopropane-1-carbonitrile?
The canonical SMILES for 1-[[[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]amino]methyl]cyclopropane-1-carbonitrile is N#CC1(CNc2nnc(CO)s2)CC1.
What is the InChIKey of 1-[[[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]amino]methyl]cyclopropane-1-carbonitrile?
The InChIKey is HMMWYIWSWSBTCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4OS/c9-4-8(1-2-8)5-10-7-12-11-6(3-13)14-7/h13H,1-3,5H2,(H,10,12).
What are the key properties of 1-[[[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]amino]methyl]cyclopropane-1-carbonitrile?
1-[[[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]amino]methyl]cyclopropane-1-carbonitrile has a molecular weight of 210.26 g/mol, XLogP of 0.75, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]amino]methyl]cyclopropane-1-carbonitrile is sourced from PubChem (CID 130671350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).