C10H17NO2 — CID 130671537
5-methyl-N-[(1R,2R)-2-methylcyclopropyl]oxolane-2-carboxamide (PubChem CID 130671537) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 5-methyl-N-[(1R,2R)-2-methylcyclopropyl]oxolane-2-carboxamide.
| Compound Name | 5-methyl-N-[(1R,2R)-2-methylcyclopropyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 130671537 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 5-methyl-N-[(1R,2R)-2-methylcyclopropyl]oxolane-2-carboxamide |
| SMILES | CC1CCC(C(=O)N[C@@H]2C[C@H]2C)O1 |
| InChI | InChI=1S/C10H17NO2/c1-6-5-8(6)11-10(12)9-4-3-7(2)13-9/h6-9H,3-5H2,1-2H3,(H,11,12)/t6-,7?,8-,9?/m1/s1 |
| InChIKey | VZWBOIFOXHNRAF-PKVQOTHRSA-N |
| XLogP | 1.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |