About 2,2-dichloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide;hydrochloride
2,2-dichloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide;hydrochloride (PubChem CID 130671549) has the molecular formula C6H8Cl3F2NO
and a molecular weight of 254.49 g/mol. Its IUPAC name is 2,2-dichloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | 2,2-dichloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide;hydrochloride |
| PubChem CID | 130671549 |
| Molecular Formula | C6H8Cl3F2NO |
| Molecular Weight | 254.49 g/mol |
| Exact Mass | 252.96 |
| IUPAC Name | 2,2-dichloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCC(F)F)C1CC1(Cl)Cl |
| InChI | InChI=1S/C6H7Cl2F2NO.ClH/c7-6(8)1-3(6)5(12)11-2-4(9)10;/h3-4H,1-2H2,(H,11,12);1H |
| InChIKey | GUYATLRZZWEBIH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.49 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide;hydrochloride?
The IUPAC name of 2,2-dichloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide;hydrochloride (CID 130671549) is 2,2-dichloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide;hydrochloride.
What is the SMILES notation for 2,2-dichloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide;hydrochloride?
The canonical SMILES for 2,2-dichloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide;hydrochloride is Cl.O=C(NCC(F)F)C1CC1(Cl)Cl.
What is the InChIKey of 2,2-dichloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide;hydrochloride?
The InChIKey is GUYATLRZZWEBIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7Cl2F2NO.ClH/c7-6(8)1-3(6)5(12)11-2-4(9)10;/h3-4H,1-2H2,(H,11,12);1H.
What are the key properties of 2,2-dichloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide;hydrochloride?
2,2-dichloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide;hydrochloride has a molecular weight of 254.49 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloro-N-(2,2-difluoroethyl)cyclopropane-1-carboxamide;hydrochloride is sourced from PubChem (CID 130671549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).