C7H9ClN4O — CID 130671600
2-chloro-1-(2,5,6,7-tetrahydrotriazolo[4,5-b]pyridin-4-yl)ethanone (PubChem CID 130671600) has the molecular formula C7H9ClN4O and a molecular weight of 200.63 g/mol. Its IUPAC name is 2-chloro-1-(2,5,6,7-tetrahydrotriazolo[4,5-b]pyridin-4-yl)ethanone.
| Compound Name | 2-chloro-1-(2,5,6,7-tetrahydrotriazolo[4,5-b]pyridin-4-yl)ethanone |
|---|---|
| PubChem CID | 130671600 |
| Molecular Formula | C7H9ClN4O |
| Molecular Weight | 200.63 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 2-chloro-1-(2,5,6,7-tetrahydrotriazolo[4,5-b]pyridin-4-yl)ethanone |
| SMILES | O=C(CCl)N1CCCc2n[nH]nc21 |
| InChI | InChI=1S/C7H9ClN4O/c8-4-6(13)12-3-1-2-5-7(12)10-11-9-5/h1-4H2,(H,9,10,11) |
| InChIKey | YYQLGIAVSLONFD-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.63 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|