3-[(1R,2S)-1-amino-2-hydroxypropyl]benzoic acid

C10H13NO3 — CID 130673379

IUPAC3-[(1R,2S)-1-amino-2-hydroxypropyl]benzoic acid
SMILESC[C@H](O)[C@H](N)c1cccc(C(=O)O)c1
InChIInChI=1S/C10H13NO3/c1-6(12)9(11)7-3-2-4-8(5-7)10(13)14/h2-6,9,12H,11H2,1H3,(H,13,14)/t6-,9-/m0/s1
InChIKeyMVRZQNTVBPQDDA-RCOVLWMOSA-N
MW195.22 g/mol
LogP0.77
Rot. Bonds3

About 3-[(1R,2S)-1-amino-2-hydroxypropyl]benzoic acid

3-[(1R,2S)-1-amino-2-hydroxypropyl]benzoic acid (PubChem CID 130673379) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-[(1R,2S)-1-amino-2-hydroxypropyl]benzoic acid.

Molecular Properties

Compound Name3-[(1R,2S)-1-amino-2-hydroxypropyl]benzoic acid
PubChem CID130673379
Molecular FormulaC10H13NO3
Molecular Weight195.22 g/mol
Exact Mass195.09
IUPAC Name3-[(1R,2S)-1-amino-2-hydroxypropyl]benzoic acid
SMILESC[C@H](O)[C@H](N)c1cccc(C(=O)O)c1
InChIInChI=1S/C10H13NO3/c1-6(12)9(11)7-3-2-4-8(5-7)10(13)14/h2-6,9,12H,11H2,1H3,(H,13,14)/t6-,9-/m0/s1
InChIKeyMVRZQNTVBPQDDA-RCOVLWMOSA-N
XLogP0.77
TPSA83.55 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.22
LogP ≤ 50.77
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-[(1R,2S)-1-amino-2-hydroxypropyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(1R,2S)-1-amino-2-hydroxypropyl]benzoic acid?
The IUPAC name of 3-[(1R,2S)-1-amino-2-hydroxypropyl]benzoic acid (CID 130673379) is 3-[(1R,2S)-1-amino-2-hydroxypropyl]benzoic acid.
What is the SMILES notation for 3-[(1R,2S)-1-amino-2-hydroxypropyl]benzoic acid?
The canonical SMILES for 3-[(1R,2S)-1-amino-2-hydroxypropyl]benzoic acid is C[C@H](O)[C@H](N)c1cccc(C(=O)O)c1.
What is the InChIKey of 3-[(1R,2S)-1-amino-2-hydroxypropyl]benzoic acid?
The InChIKey is MVRZQNTVBPQDDA-RCOVLWMOSA-N. The full InChI is InChI=1S/C10H13NO3/c1-6(12)9(11)7-3-2-4-8(5-7)10(13)14/h2-6,9,12H,11H2,1H3,(H,13,14)/t6-,9-/m0/s1.
What are the key properties of 3-[(1R,2S)-1-amino-2-hydroxypropyl]benzoic acid?
3-[(1R,2S)-1-amino-2-hydroxypropyl]benzoic acid has a molecular weight of 195.22 g/mol, XLogP of 0.77, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R,2S)-1-amino-2-hydroxypropyl]benzoic acid is sourced from PubChem (CID 130673379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).