About (3R)-3-amino-2,2-difluoro-3-(1H-pyrrol-3-yl)propan-1-ol
(3R)-3-amino-2,2-difluoro-3-(1H-pyrrol-3-yl)propan-1-ol (PubChem CID 130673652) has the molecular formula C7H10F2N2O
and a molecular weight of 176.17 g/mol. Its IUPAC name is (3R)-3-amino-2,2-difluoro-3-(1H-pyrrol-3-yl)propan-1-ol.
Molecular Properties
| Compound Name | (3R)-3-amino-2,2-difluoro-3-(1H-pyrrol-3-yl)propan-1-ol |
| PubChem CID | 130673652 |
| Molecular Formula | C7H10F2N2O |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (3R)-3-amino-2,2-difluoro-3-(1H-pyrrol-3-yl)propan-1-ol |
| SMILES | N[C@H](c1cc[nH]c1)C(F)(F)CO |
| InChI | InChI=1S/C7H10F2N2O/c8-7(9,4-12)6(10)5-1-2-11-3-5/h1-3,6,11-12H,4,10H2/t6-/m1/s1 |
| InChIKey | WFGIQOOTIJHAHK-ZCFIWIBFSA-N |
| XLogP | 0.64 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-amino-2,2-difluoro-3-(1H-pyrrol-3-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-2,2-difluoro-3-(1H-pyrrol-3-yl)propan-1-ol?
The IUPAC name of (3R)-3-amino-2,2-difluoro-3-(1H-pyrrol-3-yl)propan-1-ol (CID 130673652) is (3R)-3-amino-2,2-difluoro-3-(1H-pyrrol-3-yl)propan-1-ol.
What is the SMILES notation for (3R)-3-amino-2,2-difluoro-3-(1H-pyrrol-3-yl)propan-1-ol?
The canonical SMILES for (3R)-3-amino-2,2-difluoro-3-(1H-pyrrol-3-yl)propan-1-ol is N[C@H](c1cc[nH]c1)C(F)(F)CO.
What is the InChIKey of (3R)-3-amino-2,2-difluoro-3-(1H-pyrrol-3-yl)propan-1-ol?
The InChIKey is WFGIQOOTIJHAHK-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H10F2N2O/c8-7(9,4-12)6(10)5-1-2-11-3-5/h1-3,6,11-12H,4,10H2/t6-/m1/s1.
What are the key properties of (3R)-3-amino-2,2-difluoro-3-(1H-pyrrol-3-yl)propan-1-ol?
(3R)-3-amino-2,2-difluoro-3-(1H-pyrrol-3-yl)propan-1-ol has a molecular weight of 176.17 g/mol, XLogP of 0.64, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-2,2-difluoro-3-(1H-pyrrol-3-yl)propan-1-ol is sourced from PubChem (CID 130673652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).