About (4R)-6-chloro-3,4-dihydro-2H-chromene-4,7-diamine
(4R)-6-chloro-3,4-dihydro-2H-chromene-4,7-diamine (PubChem CID 130673761) has the molecular formula C9H11ClN2O
and a molecular weight of 198.65 g/mol. Its IUPAC name is (4R)-6-chloro-3,4-dihydro-2H-chromene-4,7-diamine.
Molecular Properties
| Compound Name | (4R)-6-chloro-3,4-dihydro-2H-chromene-4,7-diamine |
| PubChem CID | 130673761 |
| Molecular Formula | C9H11ClN2O |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | (4R)-6-chloro-3,4-dihydro-2H-chromene-4,7-diamine |
| SMILES | Nc1cc2c(cc1Cl)[C@H](N)CCO2 |
| InChI | InChI=1S/C9H11ClN2O/c10-6-3-5-7(11)1-2-13-9(5)4-8(6)12/h3-4,7H,1-2,11-12H2/t7-/m1/s1 |
| InChIKey | LSQOVZCUYCKLDQ-SSDOTTSWSA-N |
| XLogP | 1.70 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4R)-6-chloro-3,4-dihydro-2H-chromene-4,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-6-chloro-3,4-dihydro-2H-chromene-4,7-diamine?
The IUPAC name of (4R)-6-chloro-3,4-dihydro-2H-chromene-4,7-diamine (CID 130673761) is (4R)-6-chloro-3,4-dihydro-2H-chromene-4,7-diamine.
What is the SMILES notation for (4R)-6-chloro-3,4-dihydro-2H-chromene-4,7-diamine?
The canonical SMILES for (4R)-6-chloro-3,4-dihydro-2H-chromene-4,7-diamine is Nc1cc2c(cc1Cl)[C@H](N)CCO2.
What is the InChIKey of (4R)-6-chloro-3,4-dihydro-2H-chromene-4,7-diamine?
The InChIKey is LSQOVZCUYCKLDQ-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H11ClN2O/c10-6-3-5-7(11)1-2-13-9(5)4-8(6)12/h3-4,7H,1-2,11-12H2/t7-/m1/s1.
What are the key properties of (4R)-6-chloro-3,4-dihydro-2H-chromene-4,7-diamine?
(4R)-6-chloro-3,4-dihydro-2H-chromene-4,7-diamine has a molecular weight of 198.65 g/mol, XLogP of 1.70, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-6-chloro-3,4-dihydro-2H-chromene-4,7-diamine is sourced from PubChem (CID 130673761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).