About N-prop-2-enyl-3,6-dihydro-2H-pyran-4-carboxamide
N-prop-2-enyl-3,6-dihydro-2H-pyran-4-carboxamide (PubChem CID 130675976) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is N-prop-2-enyl-3,6-dihydro-2H-pyran-4-carboxamide.
Molecular Properties
| Compound Name | N-prop-2-enyl-3,6-dihydro-2H-pyran-4-carboxamide |
| PubChem CID | 130675976 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | N-prop-2-enyl-3,6-dihydro-2H-pyran-4-carboxamide |
| SMILES | C=CCNC(=O)C1=CCOCC1 |
| InChI | InChI=1S/C9H13NO2/c1-2-5-10-9(11)8-3-6-12-7-4-8/h2-3H,1,4-7H2,(H,10,11) |
| InChIKey | XOIKSLNRGCSLBG-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-enyl-3,6-dihydro-2H-pyran-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-enyl-3,6-dihydro-2H-pyran-4-carboxamide?
The IUPAC name of N-prop-2-enyl-3,6-dihydro-2H-pyran-4-carboxamide (CID 130675976) is N-prop-2-enyl-3,6-dihydro-2H-pyran-4-carboxamide.
What is the SMILES notation for N-prop-2-enyl-3,6-dihydro-2H-pyran-4-carboxamide?
The canonical SMILES for N-prop-2-enyl-3,6-dihydro-2H-pyran-4-carboxamide is C=CCNC(=O)C1=CCOCC1.
What is the InChIKey of N-prop-2-enyl-3,6-dihydro-2H-pyran-4-carboxamide?
The InChIKey is XOIKSLNRGCSLBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c1-2-5-10-9(11)8-3-6-12-7-4-8/h2-3H,1,4-7H2,(H,10,11).
What are the key properties of N-prop-2-enyl-3,6-dihydro-2H-pyran-4-carboxamide?
N-prop-2-enyl-3,6-dihydro-2H-pyran-4-carboxamide has a molecular weight of 167.21 g/mol, XLogP of 0.64, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-enyl-3,6-dihydro-2H-pyran-4-carboxamide is sourced from PubChem (CID 130675976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).