About N-methoxy-N-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine
N-methoxy-N-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 130676311) has the molecular formula C7H9N5O
and a molecular weight of 179.18 g/mol. Its IUPAC name is N-methoxy-N-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | N-methoxy-N-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| PubChem CID | 130676311 |
| Molecular Formula | C7H9N5O |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | N-methoxy-N-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | CON(C)c1ccc2nncn2n1 |
| InChI | InChI=1S/C7H9N5O/c1-11(13-2)7-4-3-6-9-8-5-12(6)10-7/h3-5H,1-2H3 |
| InChIKey | GTVQUALHOPSMDZ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-N-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-N-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine?
The IUPAC name of N-methoxy-N-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (CID 130676311) is N-methoxy-N-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
What is the SMILES notation for N-methoxy-N-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine?
The canonical SMILES for N-methoxy-N-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine is CON(C)c1ccc2nncn2n1.
What is the InChIKey of N-methoxy-N-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine?
The InChIKey is GTVQUALHOPSMDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5O/c1-11(13-2)7-4-3-6-9-8-5-12(6)10-7/h3-5H,1-2H3.
What are the key properties of N-methoxy-N-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine?
N-methoxy-N-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine has a molecular weight of 179.18 g/mol, XLogP of 0.12, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-N-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine is sourced from PubChem (CID 130676311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).