C9H17NO3 — CID 130676498
1-hydroxy-N-(2-hydroxypropyl)cyclopentane-1-carboxamide (PubChem CID 130676498) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is 1-hydroxy-N-(2-hydroxypropyl)cyclopentane-1-carboxamide.
| Compound Name | 1-hydroxy-N-(2-hydroxypropyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 130676498 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 1-hydroxy-N-(2-hydroxypropyl)cyclopentane-1-carboxamide |
| SMILES | CC(O)CNC(=O)C1(O)CCCC1 |
| InChI | InChI=1S/C9H17NO3/c1-7(11)6-10-8(12)9(13)4-2-3-5-9/h7,11,13H,2-6H2,1H3,(H,10,12) |
| InChIKey | HKCXRYWQKNDWFE-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |