About 6-ethynyl-2,5-dimethyl-1H-pyrimidine-4-thione
6-ethynyl-2,5-dimethyl-1H-pyrimidine-4-thione (PubChem CID 130677357) has the molecular formula C8H8N2S
and a molecular weight of 164.23 g/mol. Its IUPAC name is 6-ethynyl-2,5-dimethyl-1H-pyrimidine-4-thione.
Molecular Properties
| Compound Name | 6-ethynyl-2,5-dimethyl-1H-pyrimidine-4-thione |
| PubChem CID | 130677357 |
| Molecular Formula | C8H8N2S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 6-ethynyl-2,5-dimethyl-1H-pyrimidine-4-thione |
| SMILES | C#Cc1[nH]c(C)nc(=S)c1C |
| InChI | InChI=1S/C8H8N2S/c1-4-7-5(2)8(11)10-6(3)9-7/h1H,2-3H3,(H,9,10,11) |
| InChIKey | DMVULKJMEMVPSN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-ethynyl-2,5-dimethyl-1H-pyrimidine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethynyl-2,5-dimethyl-1H-pyrimidine-4-thione?
The IUPAC name of 6-ethynyl-2,5-dimethyl-1H-pyrimidine-4-thione (CID 130677357) is 6-ethynyl-2,5-dimethyl-1H-pyrimidine-4-thione.
What is the SMILES notation for 6-ethynyl-2,5-dimethyl-1H-pyrimidine-4-thione?
The canonical SMILES for 6-ethynyl-2,5-dimethyl-1H-pyrimidine-4-thione is C#Cc1[nH]c(C)nc(=S)c1C.
What is the InChIKey of 6-ethynyl-2,5-dimethyl-1H-pyrimidine-4-thione?
The InChIKey is DMVULKJMEMVPSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2S/c1-4-7-5(2)8(11)10-6(3)9-7/h1H,2-3H3,(H,9,10,11).
What are the key properties of 6-ethynyl-2,5-dimethyl-1H-pyrimidine-4-thione?
6-ethynyl-2,5-dimethyl-1H-pyrimidine-4-thione has a molecular weight of 164.23 g/mol, XLogP of 1.74, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethynyl-2,5-dimethyl-1H-pyrimidine-4-thione is sourced from PubChem (CID 130677357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).