C10H22ClN3O — CID 130677550
1-amino-N-(2-aminoethyl)-4-methylcyclohexane-1-carboxamide;hydrochloride (PubChem CID 130677550) has the molecular formula C10H22ClN3O and a molecular weight of 235.76 g/mol. Its IUPAC name is 1-amino-N-(2-aminoethyl)-4-methylcyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 1-amino-N-(2-aminoethyl)-4-methylcyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 130677550 |
| Molecular Formula | C10H22ClN3O |
| Molecular Weight | 235.76 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | 1-amino-N-(2-aminoethyl)-4-methylcyclohexane-1-carboxamide;hydrochloride |
| SMILES | CC1CCC(N)(C(=O)NCCN)CC1.Cl |
| InChI | InChI=1S/C10H21N3O.ClH/c1-8-2-4-10(12,5-3-8)9(14)13-7-6-11;/h8H,2-7,11-12H2,1H3,(H,13,14);1H |
| InChIKey | URVWTTXWLJFAFC-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.76 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |