C7H12N2O2S2 — CID 130677762
N,N,4,5-tetramethyl-1,3-thiazole-2-sulfonamide (PubChem CID 130677762) has the molecular formula C7H12N2O2S2 and a molecular weight of 220.32 g/mol. Its IUPAC name is N,N,4,5-tetramethyl-1,3-thiazole-2-sulfonamide.
| Compound Name | N,N,4,5-tetramethyl-1,3-thiazole-2-sulfonamide |
|---|---|
| PubChem CID | 130677762 |
| Molecular Formula | C7H12N2O2S2 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | N,N,4,5-tetramethyl-1,3-thiazole-2-sulfonamide |
| SMILES | Cc1nc(S(=O)(=O)N(C)C)sc1C |
| InChI | InChI=1S/C7H12N2O2S2/c1-5-6(2)12-7(8-5)13(10,11)9(3)4/h1-4H3 |
| InChIKey | ANXUOZKKQKDWNS-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |