About N-(furan-2-ylmethyl)-N-methyl-1,2,4-thiadiazol-5-amine
N-(furan-2-ylmethyl)-N-methyl-1,2,4-thiadiazol-5-amine (PubChem CID 130677953) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-methyl-1,2,4-thiadiazol-5-amine.
Analyze N-(furan-2-ylmethyl)-N-methyl-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(furan-2-ylmethyl)-N-methyl-1,2,4-thiadiazol-5-amine?
The IUPAC name of N-(furan-2-ylmethyl)-N-methyl-1,2,4-thiadiazol-5-amine (CID 130677953) is N-(furan-2-ylmethyl)-N-methyl-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for N-(furan-2-ylmethyl)-N-methyl-1,2,4-thiadiazol-5-amine?
The canonical SMILES for N-(furan-2-ylmethyl)-N-methyl-1,2,4-thiadiazol-5-amine is CN(Cc1ccco1)c1ncns1.
What is the InChIKey of N-(furan-2-ylmethyl)-N-methyl-1,2,4-thiadiazol-5-amine?
The InChIKey is PQWJCACLDRQVSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c1-11(8-9-6-10-13-8)5-7-3-2-4-12-7/h2-4,6H,5H2,1H3.
What are the key properties of N-(furan-2-ylmethyl)-N-methyl-1,2,4-thiadiazol-5-amine?
N-(furan-2-ylmethyl)-N-methyl-1,2,4-thiadiazol-5-amine has a molecular weight of 195.25 g/mol, XLogP of 1.77, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(furan-2-ylmethyl)-N-methyl-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 130677953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).