About 4-bromo-1-(ethylsulfanylmethyl)-3,5-dimethylpyrazole
4-bromo-1-(ethylsulfanylmethyl)-3,5-dimethylpyrazole (PubChem CID 130678100) has the molecular formula C8H13BrN2S
and a molecular weight of 249.18 g/mol. Its IUPAC name is 4-bromo-1-(ethylsulfanylmethyl)-3,5-dimethylpyrazole.
Analyze 4-bromo-1-(ethylsulfanylmethyl)-3,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-(ethylsulfanylmethyl)-3,5-dimethylpyrazole?
The IUPAC name of 4-bromo-1-(ethylsulfanylmethyl)-3,5-dimethylpyrazole (CID 130678100) is 4-bromo-1-(ethylsulfanylmethyl)-3,5-dimethylpyrazole.
What is the SMILES notation for 4-bromo-1-(ethylsulfanylmethyl)-3,5-dimethylpyrazole?
The canonical SMILES for 4-bromo-1-(ethylsulfanylmethyl)-3,5-dimethylpyrazole is CCSCn1nc(C)c(Br)c1C.
What is the InChIKey of 4-bromo-1-(ethylsulfanylmethyl)-3,5-dimethylpyrazole?
The InChIKey is UEJDASZBGBNVNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13BrN2S/c1-4-12-5-11-7(3)8(9)6(2)10-11/h4-5H2,1-3H3.
What are the key properties of 4-bromo-1-(ethylsulfanylmethyl)-3,5-dimethylpyrazole?
4-bromo-1-(ethylsulfanylmethyl)-3,5-dimethylpyrazole has a molecular weight of 249.18 g/mol, XLogP of 2.97, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-(ethylsulfanylmethyl)-3,5-dimethylpyrazole is sourced from PubChem (CID 130678100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).