C8H13F3N2O — CID 130678229
(4aR,7aR)-4-(2,2,2-trifluoroethyl)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine (PubChem CID 130678229) has the molecular formula C8H13F3N2O and a molecular weight of 210.20 g/mol. Its IUPAC name is (4aR,7aR)-4-(2,2,2-trifluoroethyl)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aR,7aR)-4-(2,2,2-trifluoroethyl)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 130678229 |
| Molecular Formula | C8H13F3N2O |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (4aR,7aR)-4-(2,2,2-trifluoroethyl)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine |
| SMILES | FC(F)(F)CN1CCO[C@@H]2CNC[C@H]21 |
| InChI | InChI=1S/C8H13F3N2O/c9-8(10,11)5-13-1-2-14-7-4-12-3-6(7)13/h6-7,12H,1-5H2/t6-,7-/m1/s1 |
| InChIKey | INSBFFDWJDYLCC-RNFRBKRXSA-N |
| XLogP | 0.22 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |