About N-(2,2-difluoroethyl)-2-oxo-1,3-oxazolidine-4-carboxamide
N-(2,2-difluoroethyl)-2-oxo-1,3-oxazolidine-4-carboxamide (PubChem CID 130678353) has the molecular formula C6H8F2N2O3
and a molecular weight of 194.14 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2-oxo-1,3-oxazolidine-4-carboxamide.
Molecular Properties
| Compound Name | N-(2,2-difluoroethyl)-2-oxo-1,3-oxazolidine-4-carboxamide |
| PubChem CID | 130678353 |
| Molecular Formula | C6H8F2N2O3 |
| Molecular Weight | 194.14 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | N-(2,2-difluoroethyl)-2-oxo-1,3-oxazolidine-4-carboxamide |
| SMILES | O=C1NC(C(=O)NCC(F)F)CO1 |
| InChI | InChI=1S/C6H8F2N2O3/c7-4(8)1-9-5(11)3-2-13-6(12)10-3/h3-4H,1-2H2,(H,9,11)(H,10,12) |
| InChIKey | UGBZWROMWXEPSC-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.14 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,2-difluoroethyl)-2-oxo-1,3-oxazolidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoroethyl)-2-oxo-1,3-oxazolidine-4-carboxamide?
The IUPAC name of N-(2,2-difluoroethyl)-2-oxo-1,3-oxazolidine-4-carboxamide (CID 130678353) is N-(2,2-difluoroethyl)-2-oxo-1,3-oxazolidine-4-carboxamide.
What is the SMILES notation for N-(2,2-difluoroethyl)-2-oxo-1,3-oxazolidine-4-carboxamide?
The canonical SMILES for N-(2,2-difluoroethyl)-2-oxo-1,3-oxazolidine-4-carboxamide is O=C1NC(C(=O)NCC(F)F)CO1.
What is the InChIKey of N-(2,2-difluoroethyl)-2-oxo-1,3-oxazolidine-4-carboxamide?
The InChIKey is UGBZWROMWXEPSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2N2O3/c7-4(8)1-9-5(11)3-2-13-6(12)10-3/h3-4H,1-2H2,(H,9,11)(H,10,12).
What are the key properties of N-(2,2-difluoroethyl)-2-oxo-1,3-oxazolidine-4-carboxamide?
N-(2,2-difluoroethyl)-2-oxo-1,3-oxazolidine-4-carboxamide has a molecular weight of 194.14 g/mol, XLogP of -0.52, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoroethyl)-2-oxo-1,3-oxazolidine-4-carboxamide is sourced from PubChem (CID 130678353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).