About 2-[(2-chloro-1,3-thiazol-4-yl)amino]-1-cyclopropylethanol
2-[(2-chloro-1,3-thiazol-4-yl)amino]-1-cyclopropylethanol (PubChem CID 130678424) has the molecular formula C8H11ClN2OS
and a molecular weight of 218.71 g/mol. Its IUPAC name is 2-[(2-chloro-1,3-thiazol-4-yl)amino]-1-cyclopropylethanol.
Molecular Properties
| Compound Name | 2-[(2-chloro-1,3-thiazol-4-yl)amino]-1-cyclopropylethanol |
| PubChem CID | 130678424 |
| Molecular Formula | C8H11ClN2OS |
| Molecular Weight | 218.71 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 2-[(2-chloro-1,3-thiazol-4-yl)amino]-1-cyclopropylethanol |
| SMILES | OC(CNc1csc(Cl)n1)C1CC1 |
| InChI | InChI=1S/C8H11ClN2OS/c9-8-11-7(4-13-8)10-3-6(12)5-1-2-5/h4-6,10,12H,1-3H2 |
| InChIKey | WVXFWQRCIAXFFS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.71 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2-chloro-1,3-thiazol-4-yl)amino]-1-cyclopropylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-chloro-1,3-thiazol-4-yl)amino]-1-cyclopropylethanol?
The IUPAC name of 2-[(2-chloro-1,3-thiazol-4-yl)amino]-1-cyclopropylethanol (CID 130678424) is 2-[(2-chloro-1,3-thiazol-4-yl)amino]-1-cyclopropylethanol.
What is the SMILES notation for 2-[(2-chloro-1,3-thiazol-4-yl)amino]-1-cyclopropylethanol?
The canonical SMILES for 2-[(2-chloro-1,3-thiazol-4-yl)amino]-1-cyclopropylethanol is OC(CNc1csc(Cl)n1)C1CC1.
What is the InChIKey of 2-[(2-chloro-1,3-thiazol-4-yl)amino]-1-cyclopropylethanol?
The InChIKey is WVXFWQRCIAXFFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN2OS/c9-8-11-7(4-13-8)10-3-6(12)5-1-2-5/h4-6,10,12H,1-3H2.
What are the key properties of 2-[(2-chloro-1,3-thiazol-4-yl)amino]-1-cyclopropylethanol?
2-[(2-chloro-1,3-thiazol-4-yl)amino]-1-cyclopropylethanol has a molecular weight of 218.71 g/mol, XLogP of 1.98, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-chloro-1,3-thiazol-4-yl)amino]-1-cyclopropylethanol is sourced from PubChem (CID 130678424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).