About 3-(1,2-oxazol-3-yl)-2-sulfanylideneimidazolidin-4-one
3-(1,2-oxazol-3-yl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 130678433) has the molecular formula C6H5N3O2S
and a molecular weight of 183.19 g/mol. Its IUPAC name is 3-(1,2-oxazol-3-yl)-2-sulfanylideneimidazolidin-4-one.
Molecular Properties
| Compound Name | 3-(1,2-oxazol-3-yl)-2-sulfanylideneimidazolidin-4-one |
| PubChem CID | 130678433 |
| Molecular Formula | C6H5N3O2S |
| Molecular Weight | 183.19 g/mol |
| Exact Mass | 183.01 |
| IUPAC Name | 3-(1,2-oxazol-3-yl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1CNC(=S)N1c1ccon1 |
| InChI | InChI=1S/C6H5N3O2S/c10-5-3-7-6(12)9(5)4-1-2-11-8-4/h1-2H,3H2,(H,7,12) |
| InChIKey | KFNFRXIHBTZXCD-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.19 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,2-oxazol-3-yl)-2-sulfanylideneimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2-oxazol-3-yl)-2-sulfanylideneimidazolidin-4-one?
The IUPAC name of 3-(1,2-oxazol-3-yl)-2-sulfanylideneimidazolidin-4-one (CID 130678433) is 3-(1,2-oxazol-3-yl)-2-sulfanylideneimidazolidin-4-one.
What is the SMILES notation for 3-(1,2-oxazol-3-yl)-2-sulfanylideneimidazolidin-4-one?
The canonical SMILES for 3-(1,2-oxazol-3-yl)-2-sulfanylideneimidazolidin-4-one is O=C1CNC(=S)N1c1ccon1.
What is the InChIKey of 3-(1,2-oxazol-3-yl)-2-sulfanylideneimidazolidin-4-one?
The InChIKey is KFNFRXIHBTZXCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O2S/c10-5-3-7-6(12)9(5)4-1-2-11-8-4/h1-2H,3H2,(H,7,12).
What are the key properties of 3-(1,2-oxazol-3-yl)-2-sulfanylideneimidazolidin-4-one?
3-(1,2-oxazol-3-yl)-2-sulfanylideneimidazolidin-4-one has a molecular weight of 183.19 g/mol, XLogP of -0.10, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2-oxazol-3-yl)-2-sulfanylideneimidazolidin-4-one is sourced from PubChem (CID 130678433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).