About 4-[2-(chloromethyl)prop-2-enyl]-7,7-dimethyl-1,4-thiazepane 1-oxide
4-[2-(chloromethyl)prop-2-enyl]-7,7-dimethyl-1,4-thiazepane 1-oxide (PubChem CID 130679650) has the molecular formula C11H20ClNOS
and a molecular weight of 249.81 g/mol. Its IUPAC name is 4-[2-(chloromethyl)prop-2-enyl]-7,7-dimethyl-1,4-thiazepane 1-oxide.
Molecular Properties
| Compound Name | 4-[2-(chloromethyl)prop-2-enyl]-7,7-dimethyl-1,4-thiazepane 1-oxide |
| PubChem CID | 130679650 |
| Molecular Formula | C11H20ClNOS |
| Molecular Weight | 249.81 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 4-[2-(chloromethyl)prop-2-enyl]-7,7-dimethyl-1,4-thiazepane 1-oxide |
| SMILES | C=C(CCl)CN1CCS(=O)C(C)(C)CC1 |
| InChI | InChI=1S/C11H20ClNOS/c1-10(8-12)9-13-5-4-11(2,3)15(14)7-6-13/h1,4-9H2,2-3H3 |
| InChIKey | VVJRODKAHQLLKE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.81 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(chloromethyl)prop-2-enyl]-7,7-dimethyl-1,4-thiazepane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(chloromethyl)prop-2-enyl]-7,7-dimethyl-1,4-thiazepane 1-oxide?
The IUPAC name of 4-[2-(chloromethyl)prop-2-enyl]-7,7-dimethyl-1,4-thiazepane 1-oxide (CID 130679650) is 4-[2-(chloromethyl)prop-2-enyl]-7,7-dimethyl-1,4-thiazepane 1-oxide.
What is the SMILES notation for 4-[2-(chloromethyl)prop-2-enyl]-7,7-dimethyl-1,4-thiazepane 1-oxide?
The canonical SMILES for 4-[2-(chloromethyl)prop-2-enyl]-7,7-dimethyl-1,4-thiazepane 1-oxide is C=C(CCl)CN1CCS(=O)C(C)(C)CC1.
What is the InChIKey of 4-[2-(chloromethyl)prop-2-enyl]-7,7-dimethyl-1,4-thiazepane 1-oxide?
The InChIKey is VVJRODKAHQLLKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20ClNOS/c1-10(8-12)9-13-5-4-11(2,3)15(14)7-6-13/h1,4-9H2,2-3H3.
What are the key properties of 4-[2-(chloromethyl)prop-2-enyl]-7,7-dimethyl-1,4-thiazepane 1-oxide?
4-[2-(chloromethyl)prop-2-enyl]-7,7-dimethyl-1,4-thiazepane 1-oxide has a molecular weight of 249.81 g/mol, XLogP of 2.01, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(chloromethyl)prop-2-enyl]-7,7-dimethyl-1,4-thiazepane 1-oxide is sourced from PubChem (CID 130679650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).