About 3-[[(1S,2R)-2-fluorocyclopentyl]amino]-2-methylbutanenitrile
3-[[(1S,2R)-2-fluorocyclopentyl]amino]-2-methylbutanenitrile (PubChem CID 130679778) has the molecular formula C10H17FN2
and a molecular weight of 184.26 g/mol. Its IUPAC name is 3-[[(1S,2R)-2-fluorocyclopentyl]amino]-2-methylbutanenitrile.
Molecular Properties
| Compound Name | 3-[[(1S,2R)-2-fluorocyclopentyl]amino]-2-methylbutanenitrile |
| PubChem CID | 130679778 |
| Molecular Formula | C10H17FN2 |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | 3-[[(1S,2R)-2-fluorocyclopentyl]amino]-2-methylbutanenitrile |
| SMILES | CC(C#N)C(C)N[C@H]1CCC[C@H]1F |
| InChI | InChI=1S/C10H17FN2/c1-7(6-12)8(2)13-10-5-3-4-9(10)11/h7-10,13H,3-5H2,1-2H3/t7?,8?,9-,10+/m1/s1 |
| InChIKey | XCCMVJIXHJYBJT-BMNUFHGDSA-N |
| XLogP | 2.01 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[(1S,2R)-2-fluorocyclopentyl]amino]-2-methylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(1S,2R)-2-fluorocyclopentyl]amino]-2-methylbutanenitrile?
The IUPAC name of 3-[[(1S,2R)-2-fluorocyclopentyl]amino]-2-methylbutanenitrile (CID 130679778) is 3-[[(1S,2R)-2-fluorocyclopentyl]amino]-2-methylbutanenitrile.
What is the SMILES notation for 3-[[(1S,2R)-2-fluorocyclopentyl]amino]-2-methylbutanenitrile?
The canonical SMILES for 3-[[(1S,2R)-2-fluorocyclopentyl]amino]-2-methylbutanenitrile is CC(C#N)C(C)N[C@H]1CCC[C@H]1F.
What is the InChIKey of 3-[[(1S,2R)-2-fluorocyclopentyl]amino]-2-methylbutanenitrile?
The InChIKey is XCCMVJIXHJYBJT-BMNUFHGDSA-N. The full InChI is InChI=1S/C10H17FN2/c1-7(6-12)8(2)13-10-5-3-4-9(10)11/h7-10,13H,3-5H2,1-2H3/t7?,8?,9-,10+/m1/s1.
What are the key properties of 3-[[(1S,2R)-2-fluorocyclopentyl]amino]-2-methylbutanenitrile?
3-[[(1S,2R)-2-fluorocyclopentyl]amino]-2-methylbutanenitrile has a molecular weight of 184.26 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(1S,2R)-2-fluorocyclopentyl]amino]-2-methylbutanenitrile is sourced from PubChem (CID 130679778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).