About 2-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine
2-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine (PubChem CID 130679895) has the molecular formula C8H10N4S
and a molecular weight of 194.26 g/mol. Its IUPAC name is 2-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 2-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine |
| PubChem CID | 130679895 |
| Molecular Formula | C8H10N4S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 2-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine |
| SMILES | CC(C)c1nc2c(N)ncnc2s1 |
| InChI | InChI=1S/C8H10N4S/c1-4(2)7-12-5-6(9)10-3-11-8(5)13-7/h3-4H,1-2H3,(H2,9,10,11) |
| InChIKey | KEGAPJYQBBFRST-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine?
The IUPAC name of 2-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine (CID 130679895) is 2-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine.
What is the SMILES notation for 2-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine?
The canonical SMILES for 2-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine is CC(C)c1nc2c(N)ncnc2s1.
What is the InChIKey of 2-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine?
The InChIKey is KEGAPJYQBBFRST-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4S/c1-4(2)7-12-5-6(9)10-3-11-8(5)13-7/h3-4H,1-2H3,(H2,9,10,11).
What are the key properties of 2-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine?
2-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine has a molecular weight of 194.26 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-[1,3]thiazolo[5,4-d]pyrimidin-7-amine is sourced from PubChem (CID 130679895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).