About 5-ethyl-N-(1,3-oxazol-4-ylmethyl)-1,2-oxazol-4-amine
5-ethyl-N-(1,3-oxazol-4-ylmethyl)-1,2-oxazol-4-amine (PubChem CID 130679901) has the molecular formula C9H11N3O2
and a molecular weight of 193.21 g/mol. Its IUPAC name is 5-ethyl-N-(1,3-oxazol-4-ylmethyl)-1,2-oxazol-4-amine.
Molecular Properties
| Compound Name | 5-ethyl-N-(1,3-oxazol-4-ylmethyl)-1,2-oxazol-4-amine |
| PubChem CID | 130679901 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 5-ethyl-N-(1,3-oxazol-4-ylmethyl)-1,2-oxazol-4-amine |
| SMILES | CCc1oncc1NCc1cocn1 |
| InChI | InChI=1S/C9H11N3O2/c1-2-9-8(4-12-14-9)10-3-7-5-13-6-11-7/h4-6,10H,2-3H2,1H3 |
| InChIKey | CNAQXNUKTIDWAB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-ethyl-N-(1,3-oxazol-4-ylmethyl)-1,2-oxazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-N-(1,3-oxazol-4-ylmethyl)-1,2-oxazol-4-amine?
The IUPAC name of 5-ethyl-N-(1,3-oxazol-4-ylmethyl)-1,2-oxazol-4-amine (CID 130679901) is 5-ethyl-N-(1,3-oxazol-4-ylmethyl)-1,2-oxazol-4-amine.
What is the SMILES notation for 5-ethyl-N-(1,3-oxazol-4-ylmethyl)-1,2-oxazol-4-amine?
The canonical SMILES for 5-ethyl-N-(1,3-oxazol-4-ylmethyl)-1,2-oxazol-4-amine is CCc1oncc1NCc1cocn1.
What is the InChIKey of 5-ethyl-N-(1,3-oxazol-4-ylmethyl)-1,2-oxazol-4-amine?
The InChIKey is CNAQXNUKTIDWAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2/c1-2-9-8(4-12-14-9)10-3-7-5-13-6-11-7/h4-6,10H,2-3H2,1H3.
What are the key properties of 5-ethyl-N-(1,3-oxazol-4-ylmethyl)-1,2-oxazol-4-amine?
5-ethyl-N-(1,3-oxazol-4-ylmethyl)-1,2-oxazol-4-amine has a molecular weight of 193.21 g/mol, XLogP of 1.84, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-N-(1,3-oxazol-4-ylmethyl)-1,2-oxazol-4-amine is sourced from PubChem (CID 130679901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).