C10H17N3 — CID 130679981
N,5-dimethyl-N-(2-methylpropyl)pyrimidin-2-amine (PubChem CID 130679981) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is N,5-dimethyl-N-(2-methylpropyl)pyrimidin-2-amine.
| Compound Name | N,5-dimethyl-N-(2-methylpropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 130679981 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | N,5-dimethyl-N-(2-methylpropyl)pyrimidin-2-amine |
| SMILES | Cc1cnc(N(C)CC(C)C)nc1 |
| InChI | InChI=1S/C10H17N3/c1-8(2)7-13(4)10-11-5-9(3)6-12-10/h5-6,8H,7H2,1-4H3 |
| InChIKey | URNWYAHLJCFSEX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |