About 2-methoxy-2-(1,3-thiazol-4-yl)acetaldehyde
2-methoxy-2-(1,3-thiazol-4-yl)acetaldehyde (PubChem CID 130681092) has the molecular formula C6H7NO2S
and a molecular weight of 157.19 g/mol. Its IUPAC name is 2-methoxy-2-(1,3-thiazol-4-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-methoxy-2-(1,3-thiazol-4-yl)acetaldehyde |
| PubChem CID | 130681092 |
| Molecular Formula | C6H7NO2S |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | 2-methoxy-2-(1,3-thiazol-4-yl)acetaldehyde |
| SMILES | COC(C=O)c1cscn1 |
| InChI | InChI=1S/C6H7NO2S/c1-9-6(2-8)5-3-10-4-7-5/h2-4,6H,1H3 |
| InChIKey | VSWKTBOLYNJDEH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-2-(1,3-thiazol-4-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-2-(1,3-thiazol-4-yl)acetaldehyde?
The IUPAC name of 2-methoxy-2-(1,3-thiazol-4-yl)acetaldehyde (CID 130681092) is 2-methoxy-2-(1,3-thiazol-4-yl)acetaldehyde.
What is the SMILES notation for 2-methoxy-2-(1,3-thiazol-4-yl)acetaldehyde?
The canonical SMILES for 2-methoxy-2-(1,3-thiazol-4-yl)acetaldehyde is COC(C=O)c1cscn1.
What is the InChIKey of 2-methoxy-2-(1,3-thiazol-4-yl)acetaldehyde?
The InChIKey is VSWKTBOLYNJDEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2S/c1-9-6(2-8)5-3-10-4-7-5/h2-4,6H,1H3.
What are the key properties of 2-methoxy-2-(1,3-thiazol-4-yl)acetaldehyde?
2-methoxy-2-(1,3-thiazol-4-yl)acetaldehyde has a molecular weight of 157.19 g/mol, XLogP of 1.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-2-(1,3-thiazol-4-yl)acetaldehyde is sourced from PubChem (CID 130681092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).