About (3S)-2,2-dimethyl-4-oxo-3-propan-2-ylazetidine-1-sulfonyl chloride
(3S)-2,2-dimethyl-4-oxo-3-propan-2-ylazetidine-1-sulfonyl chloride (PubChem CID 130681680) has the molecular formula C8H14ClNO3S
and a molecular weight of 239.72 g/mol. Its IUPAC name is (3S)-2,2-dimethyl-4-oxo-3-propan-2-ylazetidine-1-sulfonyl chloride.
Molecular Properties
| Compound Name | (3S)-2,2-dimethyl-4-oxo-3-propan-2-ylazetidine-1-sulfonyl chloride |
| PubChem CID | 130681680 |
| Molecular Formula | C8H14ClNO3S |
| Molecular Weight | 239.72 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | (3S)-2,2-dimethyl-4-oxo-3-propan-2-ylazetidine-1-sulfonyl chloride |
| SMILES | CC(C)[C@@H]1C(=O)N(S(=O)(=O)Cl)C1(C)C |
| InChI | InChI=1S/C8H14ClNO3S/c1-5(2)6-7(11)10(8(6,3)4)14(9,12)13/h5-6H,1-4H3/t6-/m1/s1 |
| InChIKey | NYYYYGAEPBTHJA-ZCFIWIBFSA-N |
| XLogP | 1.36 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.72 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-2,2-dimethyl-4-oxo-3-propan-2-ylazetidine-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2,2-dimethyl-4-oxo-3-propan-2-ylazetidine-1-sulfonyl chloride?
The IUPAC name of (3S)-2,2-dimethyl-4-oxo-3-propan-2-ylazetidine-1-sulfonyl chloride (CID 130681680) is (3S)-2,2-dimethyl-4-oxo-3-propan-2-ylazetidine-1-sulfonyl chloride.
What is the SMILES notation for (3S)-2,2-dimethyl-4-oxo-3-propan-2-ylazetidine-1-sulfonyl chloride?
The canonical SMILES for (3S)-2,2-dimethyl-4-oxo-3-propan-2-ylazetidine-1-sulfonyl chloride is CC(C)[C@@H]1C(=O)N(S(=O)(=O)Cl)C1(C)C.
What is the InChIKey of (3S)-2,2-dimethyl-4-oxo-3-propan-2-ylazetidine-1-sulfonyl chloride?
The InChIKey is NYYYYGAEPBTHJA-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H14ClNO3S/c1-5(2)6-7(11)10(8(6,3)4)14(9,12)13/h5-6H,1-4H3/t6-/m1/s1.
What are the key properties of (3S)-2,2-dimethyl-4-oxo-3-propan-2-ylazetidine-1-sulfonyl chloride?
(3S)-2,2-dimethyl-4-oxo-3-propan-2-ylazetidine-1-sulfonyl chloride has a molecular weight of 239.72 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2,2-dimethyl-4-oxo-3-propan-2-ylazetidine-1-sulfonyl chloride is sourced from PubChem (CID 130681680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).