C7H9ClN2O2S — CID 130683240
(3S,4R)-1-(5-chloro-1,3-thiazol-2-yl)pyrrolidine-3,4-diol (PubChem CID 130683240) has the molecular formula C7H9ClN2O2S and a molecular weight of 220.68 g/mol. Its IUPAC name is (3S,4R)-1-(5-chloro-1,3-thiazol-2-yl)pyrrolidine-3,4-diol.
| Compound Name | (3S,4R)-1-(5-chloro-1,3-thiazol-2-yl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 130683240 |
| Molecular Formula | C7H9ClN2O2S |
| Molecular Weight | 220.68 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | (3S,4R)-1-(5-chloro-1,3-thiazol-2-yl)pyrrolidine-3,4-diol |
| SMILES | O[C@@H]1CN(c2ncc(Cl)s2)C[C@@H]1O |
| InChI | InChI=1S/C7H9ClN2O2S/c8-6-1-9-7(13-6)10-2-4(11)5(12)3-10/h1,4-5,11-12H,2-3H2/t4-,5+ |
| InChIKey | PAUJEHPHATYUSP-SYDPRGILSA-N |
| XLogP | 0.34 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.68 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |