About N-but-3-yn-2-yl-N,2,3-trimethylbut-2-enamide
N-but-3-yn-2-yl-N,2,3-trimethylbut-2-enamide (PubChem CID 130683777) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is N-but-3-yn-2-yl-N,2,3-trimethylbut-2-enamide.
Molecular Properties
| Compound Name | N-but-3-yn-2-yl-N,2,3-trimethylbut-2-enamide |
| PubChem CID | 130683777 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-but-3-yn-2-yl-N,2,3-trimethylbut-2-enamide |
| SMILES | C#CC(C)N(C)C(=O)C(C)=C(C)C |
| InChI | InChI=1S/C11H17NO/c1-7-9(4)12(6)11(13)10(5)8(2)3/h1,9H,2-6H3 |
| InChIKey | BNHUHTWQUYUMBV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-but-3-yn-2-yl-N,2,3-trimethylbut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-3-yn-2-yl-N,2,3-trimethylbut-2-enamide?
The IUPAC name of N-but-3-yn-2-yl-N,2,3-trimethylbut-2-enamide (CID 130683777) is N-but-3-yn-2-yl-N,2,3-trimethylbut-2-enamide.
What is the SMILES notation for N-but-3-yn-2-yl-N,2,3-trimethylbut-2-enamide?
The canonical SMILES for N-but-3-yn-2-yl-N,2,3-trimethylbut-2-enamide is C#CC(C)N(C)C(=O)C(C)=C(C)C.
What is the InChIKey of N-but-3-yn-2-yl-N,2,3-trimethylbut-2-enamide?
The InChIKey is BNHUHTWQUYUMBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-7-9(4)12(6)11(13)10(5)8(2)3/h1,9H,2-6H3.
What are the key properties of N-but-3-yn-2-yl-N,2,3-trimethylbut-2-enamide?
N-but-3-yn-2-yl-N,2,3-trimethylbut-2-enamide has a molecular weight of 179.26 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-3-yn-2-yl-N,2,3-trimethylbut-2-enamide is sourced from PubChem (CID 130683777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).