About 2-(4,6-dimethylpyrimidin-5-yl)acetamide
2-(4,6-dimethylpyrimidin-5-yl)acetamide (PubChem CID 130683923) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-5-yl)acetamide.
Molecular Properties
| Compound Name | 2-(4,6-dimethylpyrimidin-5-yl)acetamide |
| PubChem CID | 130683923 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-5-yl)acetamide |
| SMILES | Cc1ncnc(C)c1CC(N)=O |
| InChI | InChI=1S/C8H11N3O/c1-5-7(3-8(9)12)6(2)11-4-10-5/h4H,3H2,1-2H3,(H2,9,12) |
| InChIKey | IETRGTUDVRPRRR-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,6-dimethylpyrimidin-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethylpyrimidin-5-yl)acetamide?
The IUPAC name of 2-(4,6-dimethylpyrimidin-5-yl)acetamide (CID 130683923) is 2-(4,6-dimethylpyrimidin-5-yl)acetamide.
What is the SMILES notation for 2-(4,6-dimethylpyrimidin-5-yl)acetamide?
The canonical SMILES for 2-(4,6-dimethylpyrimidin-5-yl)acetamide is Cc1ncnc(C)c1CC(N)=O.
What is the InChIKey of 2-(4,6-dimethylpyrimidin-5-yl)acetamide?
The InChIKey is IETRGTUDVRPRRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c1-5-7(3-8(9)12)6(2)11-4-10-5/h4H,3H2,1-2H3,(H2,9,12).
What are the key properties of 2-(4,6-dimethylpyrimidin-5-yl)acetamide?
2-(4,6-dimethylpyrimidin-5-yl)acetamide has a molecular weight of 165.20 g/mol, XLogP of 0.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethylpyrimidin-5-yl)acetamide is sourced from PubChem (CID 130683923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).